CAS 81316-78-1 is the registry number for 1-Nitrotriphenylene, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-nitrotriphenylene (CAS 81316-78-1) is a chemical compound with the molecular formula C18H11NO2 and a molecular weight of 273.3 g/mol. IUPAC name: 1-nitrotriphenylene. InChIKey: HCZVRRQDPKTLAK-UHFFFAOYSA-N.
| Molecular formula | C18H11NO2 |
|---|---|
| Molecular weight | 273.3 g/mol |
| IUPAC name | 1-nitrotriphenylene |
| InChIKey | HCZVRRQDPKTLAK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(C4=CC=CC=C24)C(=CC=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)