CAS 2628643-87-6 is the registry number for 5,5-Dimethyl-2-phenyl-1,3,2-dioxaborinane-d5. Offered by: TRC. Available pack sizes: 100mg.
5,5-dimethyl-2-(2,3,4,5,6-pentadeuteriophenyl)-1,3,2-dioxaborinane (CAS 2628643-87-6) is a chemical compound with the molecular formula C11H15BO2 and a molecular weight of 195.08 g/mol. IUPAC name: 5,5-dimethyl-2-(2,3,4,5,6-pentadeuteriophenyl)-1,3,2-dioxaborinane. InChIKey: FQMSNYZDFMWLGC-DKFMXDSJSA-N.
| Molecular formula | C11H15BO2 |
|---|---|
| Molecular weight | 195.08 g/mol |
| IUPAC name | 5,5-dimethyl-2-(2,3,4,5,6-pentadeuteriophenyl)-1,3,2-dioxaborinane |
| InChIKey | FQMSNYZDFMWLGC-DKFMXDSJSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])B2OCC(CO2)(C)C)[2H])[2H] |
Computed by PubChem (NCBI)