CAS 263007-66-5 appears in our catalog under these names: Buxifoliadine B, Buxifoliadine B. Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, Get quote.
1,5-dihydroxy-3-methoxy-2-[(E)-3-methylbut-1-enyl]-4-(3-methylbut-2-enyl)-10H-acridin-9-one (CAS 263007-66-5) is a chemical compound with the molecular formula C24H27NO4 and a molecular weight of 393.5 g/mol. IUPAC name: 1,5-dihydroxy-3-methoxy-2-[(E)-3-methylbut-1-enyl]-4-(3-methylbut-2-enyl)-10H-acridin-9-one. InChIKey: OGGCFHYBYKFLLD-ZRDIBKRKSA-N.
| Molecular formula | C24H27NO4 |
|---|---|
| Molecular weight | 393.5 g/mol |
| IUPAC name | 1,5-dihydroxy-3-methoxy-2-[(E)-3-methylbut-1-enyl]-4-(3-methylbut-2-enyl)-10H-acridin-9-one |
| InChIKey | OGGCFHYBYKFLLD-ZRDIBKRKSA-N |
| SMILES | CC(C)/C=C/C1=C(C(=C2C(=C1O)C(=O)C3=C(N2)C(=CC=C3)O)CC=C(C)C)OC |
Computed by PubChem (NCBI)