CAS 263026-75-1 is the registry number for Methyl 6-(dimethylamino)-4-hydroxy-2-naphthoate. Offered by: Biosynth. Available pack sizes: 5000mg.
Methyl 6-(dimethylamino)-4-hydroxynaphthalene-2-carboxylate (CAS 263026-75-1) is a chemical compound with the molecular formula C14H15NO3 and a molecular weight of 245.27 g/mol. IUPAC name: methyl 6-(dimethylamino)-4-hydroxynaphthalene-2-carboxylate. InChIKey: NGYJVUQZTJCWLD-UHFFFAOYSA-N.
| Molecular formula | C14H15NO3 |
|---|---|
| Molecular weight | 245.27 g/mol |
| IUPAC name | methyl 6-(dimethylamino)-4-hydroxynaphthalene-2-carboxylate |
| InChIKey | NGYJVUQZTJCWLD-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC2=C(C=C(C=C2C=C1)C(=O)OC)O |
Computed by PubChem (NCBI)