CAS 2632308-30-4 is the registry number for tert-Butyl (R)-1-methyl-2,8-diazaspiro[4.5]decane-8-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (1R)-1-methyl-2,8-diazaspiro[4.5]decane-8-carboxylate (CAS 2632308-30-4) is a chemical compound with the molecular formula C14H26N2O2 and a molecular weight of 254.37 g/mol. IUPAC name: tert-butyl (1R)-1-methyl-2,8-diazaspiro[4.5]decane-8-carboxylate. InChIKey: CNVRGWXVVPBORV-LLVKDONJSA-N.
| Molecular formula | C14H26N2O2 |
|---|---|
| Molecular weight | 254.37 g/mol |
| IUPAC name | tert-butyl (1R)-1-methyl-2,8-diazaspiro[4.5]decane-8-carboxylate |
| InChIKey | CNVRGWXVVPBORV-LLVKDONJSA-N |
| SMILES | C[C@@H]1C2(CCN1)CCN(CC2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)