Products 2632308-34-8
CAS 2632308-34-8 is the registry number for tert-Butyl (S)-4-cyano-4-(2-hydroxypropyl)piperidine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 4-cyano-4-[(2S)-2-hydroxypropyl]piperidine-1-carboxylate (CAS 2632308-34-8) is a chemical compound with the molecular formula C14H24N2O3 and a molecular weight of 268.35 g/mol. IUPAC name: tert-butyl 4-cyano-4-[(2S)-2-hydroxypropyl]piperidine-1-carboxylate. InChIKey: NCZMRZMPPUIDAY-NSHDSACASA-N.
| Molecular formula | C14H24N2O3 |
|---|---|
| Molecular weight | 268.35 g/mol |
| IUPAC name | tert-butyl 4-cyano-4-[(2S)-2-hydroxypropyl]piperidine-1-carboxylate |
| InChIKey | NCZMRZMPPUIDAY-NSHDSACASA-N |
| SMILES | C[C@@H](CC1(CCN(CC1)C(=O)OC(C)(C)C)C#N)O |
Computed by PubChem (NCBI)