Products 2633035-02-4
CAS 2633035-02-4 is the registry number for (R)-N-(4-cyclopropylbuta-2,3-dien-1-yl)-4-methylbenzenesulfonamide, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
N-(4-cyclopropylbuta-2,3-dienyl)-4-methylbenzenesulfonamide (CAS 2633035-02-4) is a chemical compound with the molecular formula C14H17NO2S and a molecular weight of 263.36 g/mol. IUPAC name: N-(4-cyclopropylbuta-2,3-dienyl)-4-methylbenzenesulfonamide. InChIKey: RZSHAUORLSBMSA-UHFFFAOYSA-N.
| Molecular formula | C14H17NO2S |
|---|---|
| Molecular weight | 263.36 g/mol |
| IUPAC name | N-(4-cyclopropylbuta-2,3-dienyl)-4-methylbenzenesulfonamide |
| InChIKey | RZSHAUORLSBMSA-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NCC=C=CC2CC2 |
Computed by PubChem (NCBI)