CAS 97188-28-8 is the registry number for 3–(tert–Butyl)–1–(phenylsulfonyl)–1H–pyrrole. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
1-(benzenesulfonyl)-3-tert-butylpyrrole (CAS 97188-28-8) is a chemical compound with the molecular formula C14H17NO2S and a molecular weight of 263.36 g/mol. IUPAC name: 1-(benzenesulfonyl)-3-tert-butylpyrrole. InChIKey: AEJXCACOHQTSMS-UHFFFAOYSA-N.
| Molecular formula | C14H17NO2S |
|---|---|
| Molecular weight | 263.36 g/mol |
| IUPAC name | 1-(benzenesulfonyl)-3-tert-butylpyrrole |
| InChIKey | AEJXCACOHQTSMS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CN(C=C1)S(=O)(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)