CAS 263330-61-6 is the registry number for 1-Amino-1-deoxy-L-ribitol. Offered by: TRC. Available pack sizes: 1g.
(2S,3R,4R)-5-aminopentane-1,2,3,4-tetrol (CAS 263330-61-6) is a chemical compound with the molecular formula C5H13NO4 and a molecular weight of 151.16 g/mol. IUPAC name: (2S,3R,4R)-5-aminopentane-1,2,3,4-tetrol. InChIKey: RNHXWPCUJTZBAR-MROZADKFSA-N.
| Molecular formula | C5H13NO4 |
|---|---|
| Molecular weight | 151.16 g/mol |
| IUPAC name | (2S,3R,4R)-5-aminopentane-1,2,3,4-tetrol |
| InChIKey | RNHXWPCUJTZBAR-MROZADKFSA-N |
| SMILES | C([C@H]([C@H]([C@H](CO)O)O)O)N |
Computed by PubChem (NCBI)