CAS 51108-70-4 appears in our catalog under these names: 1-Amino-1-deoxyribitol, 1-Amino-1-deoxy-D-ribitol. Offered by: TRC, Biosynth. Available pack sizes: 1g, 2g, 5g.
(2R,3S,4S)-5-aminopentane-1,2,3,4-tetrol (CAS 51108-70-4) is a chemical compound with the molecular formula C5H13NO4 and a molecular weight of 151.16 g/mol. IUPAC name: (2R,3S,4S)-5-aminopentane-1,2,3,4-tetrol. InChIKey: RNHXWPCUJTZBAR-LMVFSUKVSA-N.
| Molecular formula | C5H13NO4 |
|---|---|
| Molecular weight | 151.16 g/mol |
| IUPAC name | (2R,3S,4S)-5-aminopentane-1,2,3,4-tetrol |
| InChIKey | RNHXWPCUJTZBAR-LMVFSUKVSA-N |
| SMILES | C([C@@H]([C@@H]([C@@H](CO)O)O)O)N |
Computed by PubChem (NCBI)