Products 26335-61-5

CAS 26335-61-5 is the registry number for 2-Propenoic acid, 2-methyl-, ethyl ester, polymer with 2-hydroxyethyl 2-methyl-2-propenoate. Offered by: Chemat. Available pack sizes: 1g, 5g, 25g.

Structural formula: {0} (CAS {1})

Ethyl 2-methylprop-2-enoate;2-hydroxyethyl 2-methylprop-2-enoate (CAS 26335-61-5) is a chemical compound with the molecular formula C12H20O5 and a molecular weight of 244.28 g/mol. IUPAC name: ethyl 2-methylprop-2-enoate;2-hydroxyethyl 2-methylprop-2-enoate. InChIKey: YXDZNWKMCVFFBD-UHFFFAOYSA-N.

Identity
Molecular formulaC12H20O5
Molecular weight244.28 g/mol
IUPAC nameethyl 2-methylprop-2-enoate;2-hydroxyethyl 2-methylprop-2-enoate
InChIKeyYXDZNWKMCVFFBD-UHFFFAOYSA-N
SMILESCCOC(=O)C(=C)C.CC(=C)C(=O)OCCO

Computed by PubChem (NCBI)