Products 40833-03-2

CAS 40833-03-2 is the registry number for Diethyl 4-oxooctanedioate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Diethyl 4-oxooctanedioate (CAS 40833-03-2) is a chemical compound with the molecular formula C12H20O5 and a molecular weight of 244.28 g/mol. IUPAC name: diethyl 4-oxooctanedioate. InChIKey: RKVHDMUAYAAHLF-UHFFFAOYSA-N.

Identity
Molecular formulaC12H20O5
Molecular weight244.28 g/mol
IUPAC namediethyl 4-oxooctanedioate
InChIKeyRKVHDMUAYAAHLF-UHFFFAOYSA-N
SMILESCCOC(=O)CCCC(=O)CCC(=O)OCC

Computed by PubChem (NCBI)