CAS 26340-89-6 appears in our catalog under these names: H–Arg–OMe·2HCl, H-L-Arg-OMe*2HCl, L-Arginine methyl ester dihydrochloride, 98% , L-Arginine methyl ester dihydrochloride, H-Arg-OMe.2HCl, >98.0%(N)(T). Offered by: GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar), Biosynth, TCI. Available pack sizes: 100g, 25g, 5g, 250g, 500g, 1000g, 2000g, 10g.
Methyl (2S)-2-amino-5-(diaminomethylideneamino)pentanoate;dihydrochloride (CAS 26340-89-6) is a chemical compound with the molecular formula C7H18Cl2N4O2 and a molecular weight of 261.15 g/mol. IUPAC name: methyl (2S)-2-amino-5-(diaminomethylideneamino)pentanoate;dihydrochloride. InChIKey: XQYZOBNLCUAXLF-XRIGFGBMSA-N.
| Molecular formula | C7H18Cl2N4O2 |
|---|---|
| Molecular weight | 261.15 g/mol |
| IUPAC name | methyl (2S)-2-amino-5-(diaminomethylideneamino)pentanoate;dihydrochloride |
| InChIKey | XQYZOBNLCUAXLF-XRIGFGBMSA-N |
| SMILES | COC(=O)[C@H](CCCN=C(N)N)N.Cl.Cl |
Computed by PubChem (NCBI)