CAS 78851-84-0 appears in our catalog under these names: H–D–Arg–OMe · 2 HCl, H-D-Arg-OMe*2HCl, D-Arginine Methyl Ester Dihydrochloride, >98.0%(N)(T), H-D-Arg-OMe·2HCl 98%, H-D-ARG-OME 2HCL, 98%, 98%. Offered by: GLPBio, Iris Biotech, TCI, Ambeed, Chemat. Available pack sizes: 25g, 5g, 1g, 100g, 10g.
Methyl (2R)-2-amino-5-(diaminomethylideneamino)pentanoate;dihydrochloride (CAS 78851-84-0) is a chemical compound with the molecular formula C7H18Cl2N4O2 and a molecular weight of 261.15 g/mol. IUPAC name: methyl (2R)-2-amino-5-(diaminomethylideneamino)pentanoate;dihydrochloride. InChIKey: XQYZOBNLCUAXLF-ZJIMSODOSA-N.
| Molecular formula | C7H18Cl2N4O2 |
|---|---|
| Molecular weight | 261.15 g/mol |
| IUPAC name | methyl (2R)-2-amino-5-(diaminomethylideneamino)pentanoate;dihydrochloride |
| InChIKey | XQYZOBNLCUAXLF-ZJIMSODOSA-N |
| SMILES | COC(=O)[C@@H](CCCN=C(N)N)N.Cl.Cl |
Computed by PubChem (NCBI)