Products 2634687-62-8
CAS 2634687-62-8 appears in our catalog under these names: (S)-4-Isopropyl-2-(1,8-naphthyridin-2-yl)-4,5-dihydrooxazole, 97% 99%ee, (S)-4-Isopropyl-2-(1,6-naphthyridin-2-yl)-4,5-dihydrooxazole, 97% 99%ee. Offered by: Ambeed, Fluorochem, BLDpharm, Chemat. Available pack sizes: 250mg, 100mg, 50mg.
(4S)-2-(1,8-naphthyridin-2-yl)-4-propan-2-yl-4,5-dihydro-1,3-oxazole (CAS 2634687-62-8) is a chemical compound with the molecular formula C14H15N3O and a molecular weight of 241.29 g/mol. IUPAC name: (4S)-2-(1,8-naphthyridin-2-yl)-4-propan-2-yl-4,5-dihydro-1,3-oxazole. InChIKey: MXGVSUNPVBKRCD-GFCCVEGCSA-N.
| Molecular formula | C14H15N3O |
|---|---|
| Molecular weight | 241.29 g/mol |
| IUPAC name | (4S)-2-(1,8-naphthyridin-2-yl)-4-propan-2-yl-4,5-dihydro-1,3-oxazole |
| InChIKey | MXGVSUNPVBKRCD-GFCCVEGCSA-N |
| SMILES | CC(C)[C@H]1COC(=N1)C2=NC3=C(C=CC=N3)C=C2 |
Computed by PubChem (NCBI)