CAS 2634687-69-5 appears in our catalog under these names: (S)-4-(tert-Butyl)-2-(1,8-naphthyridin-2-yl)-4,5-dihydrooxazole, 97% 99%ee, 97% 99%ee, (S)-4-(tert-Butyl)-2-(1,8-naphthyridin-2-yl)-4,5-dihydrooxazole, 97% 99%ee. Offered by: Chemat, Fluorochem. Available pack sizes: 25mg, 50mg.
(4S)-4-tert-butyl-2-(1,8-naphthyridin-2-yl)-4,5-dihydro-1,3-oxazole (CAS 2634687-69-5) is a chemical compound with the molecular formula C15H17N3O and a molecular weight of 255.31 g/mol. IUPAC name: (4S)-4-tert-butyl-2-(1,8-naphthyridin-2-yl)-4,5-dihydro-1,3-oxazole. InChIKey: JVJLNFRXYYATTD-GFCCVEGCSA-N.
| Molecular formula | C15H17N3O |
|---|---|
| Molecular weight | 255.31 g/mol |
| IUPAC name | (4S)-4-tert-butyl-2-(1,8-naphthyridin-2-yl)-4,5-dihydro-1,3-oxazole |
| InChIKey | JVJLNFRXYYATTD-GFCCVEGCSA-N |
| SMILES | CC(C)(C)[C@H]1COC(=N1)C2=NC3=C(C=CC=N3)C=C2 |
Computed by PubChem (NCBI)