CAS 26348-68-5 appears in our catalog under these names: Z–Lys–OMe · HCl, N-alpha-Z-L-lysine methyl ester hydrochloride, Z-Lys-OMe HCl 95%, (S)-Methyl 6-amino-2-(((benzyloxy)carbonyl)amino)hexanoate hydrochloride, 95%, 95%, Z-Lys-OMe (hydrochloride), 99.64%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, MedChemExpress. Available pack sizes: 5g, 1g, 2g, 10g, 25g, 100g, 100mg, 250mg.
Methyl (2S)-6-amino-2-(phenylmethoxycarbonylamino)hexanoate;hydrochloride (CAS 26348-68-5) is a chemical compound with the molecular formula C15H23ClN2O4 and a molecular weight of 330.81 g/mol. IUPAC name: methyl (2S)-6-amino-2-(phenylmethoxycarbonylamino)hexanoate;hydrochloride. InChIKey: JRPJBBBQIKFKEB-ZOWNYOTGSA-N.
| Molecular formula | C15H23ClN2O4 |
|---|---|
| Molecular weight | 330.81 g/mol |
| IUPAC name | methyl (2S)-6-amino-2-(phenylmethoxycarbonylamino)hexanoate;hydrochloride |
| InChIKey | JRPJBBBQIKFKEB-ZOWNYOTGSA-N |
| SMILES | COC(=O)[C@H](CCCCN)NC(=O)OCC1=CC=CC=C1.Cl |
Computed by PubChem (NCBI)