CAS 879646-17-0 appears in our catalog under these names: 4-(2,3,4-Trimethoxybenzyl)-1-piperazinecarboxaldehyde hydrochloride, 95%, N-Formyl Trimetazidine HCl, N-Formyl Trimetazidine Hydrochloride, 1-Formyl-4-(2,3,4-trimethoxybenzyl)piperazine Hydrochloride, 4-(2,3,4-Trimethoxybenzyl)-1-piperazine-carboxaldehyde hydrochloride, >95% (HPLC). Offered by: Combi-blocks, Chemat Brand, Mikromol, TRC, Biosynth. Available pack sizes: 250mg, 1g, 100mg, on request, 25mg, 10mg, 2,5mg, 5mg.
4-[(2,3,4-trimethoxyphenyl)methyl]piperazine-1-carbaldehyde;hydrochloride (CAS 879646-17-0) is a chemical compound with the molecular formula C15H23ClN2O4 and a molecular weight of 330.81 g/mol. IUPAC name: 4-[(2,3,4-trimethoxyphenyl)methyl]piperazine-1-carbaldehyde;hydrochloride. InChIKey: NEFRUZDKTRHROW-UHFFFAOYSA-N.
| Molecular formula | C15H23ClN2O4 |
|---|---|
| Molecular weight | 330.81 g/mol |
| IUPAC name | 4-[(2,3,4-trimethoxyphenyl)methyl]piperazine-1-carbaldehyde;hydrochloride |
| InChIKey | NEFRUZDKTRHROW-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)CN2CCN(CC2)C=O)OC)OC.Cl |
Computed by PubChem (NCBI)