CAS 2635339-86-3 is the registry number for (1R,2R)-N1,N1-Dimethyl-1,2-diphenylethane-1,2-diamine dihydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(1R,2R)-N',N'-dimethyl-1,2-diphenylethane-1,2-diamine;dihydrochloride (CAS 2635339-86-3) is a chemical compound with the molecular formula C16H22Cl2N2 and a molecular weight of 313.3 g/mol. IUPAC name: (1R,2R)-N',N'-dimethyl-1,2-diphenylethane-1,2-diamine;dihydrochloride. InChIKey: BCDPUDZKKDUMBV-UWGSCQAASA-N.
| Molecular formula | C16H22Cl2N2 |
|---|---|
| Molecular weight | 313.3 g/mol |
| IUPAC name | (1R,2R)-N',N'-dimethyl-1,2-diphenylethane-1,2-diamine;dihydrochloride |
| InChIKey | BCDPUDZKKDUMBV-UWGSCQAASA-N |
| SMILES | CN(C)[C@H](C1=CC=CC=C1)[C@@H](C2=CC=CC=C2)N.Cl.Cl |
Computed by PubChem (NCBI)