CAS 76787-89-8 appears in our catalog under these names: 3,3'-Diethylbenzidine dihydrochloride, 95%, 3,3'–Diethyl–(1,1'–biphenyl)–4,4'–diamine hydrochloride, 3,3'-Diethylbenzidine diHCl. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 250mg, 1g, 200mg.
4-(4-amino-3-ethylphenyl)-2-ethylaniline;dihydrochloride (CAS 76787-89-8) is a chemical compound with the molecular formula C16H22Cl2N2 and a molecular weight of 313.3 g/mol. IUPAC name: 4-(4-amino-3-ethylphenyl)-2-ethylaniline;dihydrochloride. InChIKey: DQPPOEIMMLEMPW-UHFFFAOYSA-N.
| Molecular formula | C16H22Cl2N2 |
|---|---|
| Molecular weight | 313.3 g/mol |
| IUPAC name | 4-(4-amino-3-ethylphenyl)-2-ethylaniline;dihydrochloride |
| InChIKey | DQPPOEIMMLEMPW-UHFFFAOYSA-N |
| SMILES | CCC1=C(C=CC(=C1)C2=CC(=C(C=C2)N)CC)N.Cl.Cl |
Computed by PubChem (NCBI)