CAS 2636710-78-4 is the registry number for SR-1815. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-cyclopentyl-N-(5-cyclopentyl-1H-pyrazol-3-yl)-2-oxo-3H-benzimidazole-5-carboxamide (CAS 2636710-78-4) is a chemical compound with the molecular formula C21H25N5O2 and a molecular weight of 379.5 g/mol. IUPAC name: 1-cyclopentyl-N-(5-cyclopentyl-1H-pyrazol-3-yl)-2-oxo-3H-benzimidazole-5-carboxamide. InChIKey: AXSRMPJKEJIYLA-UHFFFAOYSA-N.
| Molecular formula | C21H25N5O2 |
|---|---|
| Molecular weight | 379.5 g/mol |
| IUPAC name | 1-cyclopentyl-N-(5-cyclopentyl-1H-pyrazol-3-yl)-2-oxo-3H-benzimidazole-5-carboxamide |
| InChIKey | AXSRMPJKEJIYLA-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)C2=CC(=NN2)NC(=O)C3=CC4=C(C=C3)N(C(=O)N4)C5CCCC5 |
Computed by PubChem (NCBI)