CAS 89848-19-1 is the registry number for Itraconazole Impurity 25. Offered by: Chemat Brand. Available pack sizes: on request.
4-[4-[4-(4-hydroxyphenyl)piperazin-1-yl]phenyl]-2-propan-2-yl-1,2,4-triazol-3-one (CAS 89848-19-1) is a chemical compound with the molecular formula C21H25N5O2 and a molecular weight of 379.5 g/mol. IUPAC name: 4-[4-[4-(4-hydroxyphenyl)piperazin-1-yl]phenyl]-2-propan-2-yl-1,2,4-triazol-3-one. InChIKey: QDIXRTOYOSHXMN-UHFFFAOYSA-N.
| Molecular formula | C21H25N5O2 |
|---|---|
| Molecular weight | 379.5 g/mol |
| IUPAC name | 4-[4-[4-(4-hydroxyphenyl)piperazin-1-yl]phenyl]-2-propan-2-yl-1,2,4-triazol-3-one |
| InChIKey | QDIXRTOYOSHXMN-UHFFFAOYSA-N |
| SMILES | CC(C)N1C(=O)N(C=N1)C2=CC=C(C=C2)N3CCN(CC3)C4=CC=C(C=C4)O |
Computed by PubChem (NCBI)