CAS 2637389-24-1 is the registry number for 5-Fluoro-4,6-dimethyl-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-fluoro-4,6-dimethyl-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid (CAS 2637389-24-1) is a chemical compound with the molecular formula C10H9FN2O2 and a molecular weight of 208.19 g/mol. IUPAC name: 5-fluoro-4,6-dimethyl-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid. InChIKey: ZIWYLYXPPUNFPZ-UHFFFAOYSA-N.
| Molecular formula | C10H9FN2O2 |
|---|---|
| Molecular weight | 208.19 g/mol |
| IUPAC name | 5-fluoro-4,6-dimethyl-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid |
| InChIKey | ZIWYLYXPPUNFPZ-UHFFFAOYSA-N |
| SMILES | CC1=C2C=C(NC2=NC(=C1F)C)C(=O)O |
Computed by PubChem (NCBI)