Products 263754-93-4
CAS 263754-93-4 is the registry number for LA-419. Offered by: MedChemExpress. Available pack sizes: Get quote.
S-[(3R,3aS,6S,6aS)-3-nitrooxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] ethanethioate (CAS 263754-93-4) is a chemical compound with the molecular formula C8H11NO6S and a molecular weight of 249.24 g/mol. IUPAC name: S-[(3R,3aS,6S,6aS)-3-nitrooxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] ethanethioate. InChIKey: BXZDULYKEZVEEK-ULAWRXDQSA-N.
| Molecular formula | C8H11NO6S |
|---|---|
| Molecular weight | 249.24 g/mol |
| IUPAC name | S-[(3R,3aS,6S,6aS)-3-nitrooxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] ethanethioate |
| InChIKey | BXZDULYKEZVEEK-ULAWRXDQSA-N |
| SMILES | CC(=O)S[C@H]1CO[C@H]2[C@@H]1OC[C@H]2O[N+](=O)[O-] |
Computed by PubChem (NCBI)