CAS 263903-18-0 is the registry number for 2,2-Dimethylchromane-8-carbaldehyde, 95%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
2,2-dimethyl-3,4-dihydrochromene-8-carbaldehyde (CAS 263903-18-0) is a chemical compound with the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. IUPAC name: 2,2-dimethyl-3,4-dihydrochromene-8-carbaldehyde. InChIKey: RIDVVSLGHIBFMK-UHFFFAOYSA-N.
| Molecular formula | C12H14O2 |
|---|---|
| Molecular weight | 190.24 g/mol |
| IUPAC name | 2,2-dimethyl-3,4-dihydrochromene-8-carbaldehyde |
| InChIKey | RIDVVSLGHIBFMK-UHFFFAOYSA-N |
| SMILES | CC1(CCC2=C(O1)C(=CC=C2)C=O)C |
Computed by PubChem (NCBI)