CAS 2639625-82-2 is the registry number for 1-Chloro-3-cyclobutoxy-2-fluoro-5-nitrobenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1-chloro-3-cyclobutyloxy-2-fluoro-5-nitrobenzene (CAS 2639625-82-2) is a chemical compound with the molecular formula C10H9ClFNO3 and a molecular weight of 245.63 g/mol. IUPAC name: 1-chloro-3-cyclobutyloxy-2-fluoro-5-nitrobenzene. InChIKey: LFUCPNUKIAMONS-UHFFFAOYSA-N.
| Molecular formula | C10H9ClFNO3 |
|---|---|
| Molecular weight | 245.63 g/mol |
| IUPAC name | 1-chloro-3-cyclobutyloxy-2-fluoro-5-nitrobenzene |
| InChIKey | LFUCPNUKIAMONS-UHFFFAOYSA-N |
| SMILES | C1CC(C1)OC2=C(C(=CC(=C2)[N+](=O)[O-])Cl)F |
Computed by PubChem (NCBI)