Products 2892007-64-4
CAS 2892007-64-4 is the registry number for 1-Methylethyl 2-chloro-4-fluoro-α-oxo-3-pyridineacetate, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
Propan-2-yl 2-(2-chloro-4-fluoro-3-pyridinyl)-2-oxoacetate (CAS 2892007-64-4) is a chemical compound with the molecular formula C10H9ClFNO3 and a molecular weight of 245.63 g/mol. IUPAC name: propan-2-yl 2-(2-chloro-4-fluoro-3-pyridinyl)-2-oxoacetate. InChIKey: VYFMXUFEUZAJRO-UHFFFAOYSA-N.
| Molecular formula | C10H9ClFNO3 |
|---|---|
| Molecular weight | 245.63 g/mol |
| IUPAC name | propan-2-yl 2-(2-chloro-4-fluoro-3-pyridinyl)-2-oxoacetate |
| InChIKey | VYFMXUFEUZAJRO-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)C(=O)C1=C(C=CN=C1Cl)F |
Computed by PubChem (NCBI)