CAS 2640-58-6 appears in our catalog under these names: N2-Benzyloxycarbonyl-L-ornithine, Z–Orn–OH, Z-L-Orn-OH, N-alpha-Z-L-ornithine, Z-Orn-OH, 98.00%. Offered by: TRC, GLPBio, Iris Biotech, Biosynth, Chemat. Available pack sizes: 10g, 25g, 5g, 100g, 0,05kg, 1g, 500g, 250mg.
(2S)-5-amino-2-(phenylmethoxycarbonylamino)pentanoic acid (CAS 2640-58-6) is a chemical compound with the molecular formula C13H18N2O4 and a molecular weight of 266.29 g/mol. IUPAC name: (2S)-5-amino-2-(phenylmethoxycarbonylamino)pentanoic acid. InChIKey: ZYGRWJVRLNJIMR-NSHDSACASA-N.
| Molecular formula | C13H18N2O4 |
|---|---|
| Molecular weight | 266.29 g/mol |
| IUPAC name | (2S)-5-amino-2-(phenylmethoxycarbonylamino)pentanoic acid |
| InChIKey | ZYGRWJVRLNJIMR-NSHDSACASA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@@H](CCCN)C(=O)O |
Computed by PubChem (NCBI)