Products 2640220-51-3
CAS 2640220-51-3 is the registry number for Tubulin polymerization-IN-42. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-(1-methylindol-3-yl)-4-(3,4,5-trimethoxyphenyl)-2H-furan-5-one (CAS 2640220-51-3) is a chemical compound with the molecular formula C22H21NO5 and a molecular weight of 379.4 g/mol. IUPAC name: 3-(1-methylindol-3-yl)-4-(3,4,5-trimethoxyphenyl)-2H-furan-5-one. InChIKey: TWAPIXHGRUSSFP-UHFFFAOYSA-N.
| Molecular formula | C22H21NO5 |
|---|---|
| Molecular weight | 379.4 g/mol |
| IUPAC name | 3-(1-methylindol-3-yl)-4-(3,4,5-trimethoxyphenyl)-2H-furan-5-one |
| InChIKey | TWAPIXHGRUSSFP-UHFFFAOYSA-N |
| SMILES | CN1C=C(C2=CC=CC=C21)C3=C(C(=O)OC3)C4=CC(=C(C(=C4)OC)OC)OC |
Computed by PubChem (NCBI)
Synonyms:
Tubulin polymerization-IN-42, orb1944292