CAS 2641064-80-2 is the registry number for tert-Butyl (S)-(5-(3-aminophenyl)-5-methyl-5,6-dihydro-2H-1,4-oxazin-3-yl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[(5S)-5-(3-aminophenyl)-5-methyl-2,6-dihydro-1,4-oxazin-3-yl]carbamate (CAS 2641064-80-2) is a chemical compound with the molecular formula C16H23N3O3 and a molecular weight of 305.37 g/mol. IUPAC name: tert-butyl N-[(5S)-5-(3-aminophenyl)-5-methyl-2,6-dihydro-1,4-oxazin-3-yl]carbamate. InChIKey: AQZFZFHRPJASGK-MRXNPFEDSA-N.
| Molecular formula | C16H23N3O3 |
|---|---|
| Molecular weight | 305.37 g/mol |
| IUPAC name | tert-butyl N-[(5S)-5-(3-aminophenyl)-5-methyl-2,6-dihydro-1,4-oxazin-3-yl]carbamate |
| InChIKey | AQZFZFHRPJASGK-MRXNPFEDSA-N |
| SMILES | C[C@@]1(COCC(=N1)NC(=O)OC(C)(C)C)C2=CC(=CC=C2)N |
Computed by PubChem (NCBI)