Products 1366085-72-4

CAS 1366085-72-4 is the registry number for Bendamustine Impurity 44. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Ethyl 4-[5-(2-hydroxyethylamino)-1-methylbenzimidazol-2-yl]butanoate (CAS 1366085-72-4) is a chemical compound with the molecular formula C16H23N3O3 and a molecular weight of 305.37 g/mol. IUPAC name: ethyl 4-[5-(2-hydroxyethylamino)-1-methylbenzimidazol-2-yl]butanoate. InChIKey: MPBSSXAVWKDHMB-UHFFFAOYSA-N.

Identity
Molecular formulaC16H23N3O3
Molecular weight305.37 g/mol
IUPAC nameethyl 4-[5-(2-hydroxyethylamino)-1-methylbenzimidazol-2-yl]butanoate
InChIKeyMPBSSXAVWKDHMB-UHFFFAOYSA-N
SMILESCCOC(=O)CCCC1=NC2=C(N1C)C=CC(=C2)NCCO

Computed by PubChem (NCBI)