Products 1119451-56-7

CAS 1119451-56-7 is the registry number for 4-([4-(4-Ethylpiperazin-1-yl)phenyl]amino)-4-oxobutanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

4-[4-(4-ethylpiperazin-1-yl)anilino]-4-oxobutanoic acid (CAS 1119451-56-7) is a chemical compound with the molecular formula C16H23N3O3 and a molecular weight of 305.37 g/mol. IUPAC name: 4-[4-(4-ethylpiperazin-1-yl)anilino]-4-oxobutanoic acid. InChIKey: YMRXJZXNHWECCD-UHFFFAOYSA-N.

Identity
Molecular formulaC16H23N3O3
Molecular weight305.37 g/mol
IUPAC name4-[4-(4-ethylpiperazin-1-yl)anilino]-4-oxobutanoic acid
InChIKeyYMRXJZXNHWECCD-UHFFFAOYSA-N
SMILESCCN1CCN(CC1)C2=CC=C(C=C2)NC(=O)CCC(=O)O

Computed by PubChem (NCBI)