Products 2641451-61-6
CAS 2641451-61-6 is the registry number for 3-(5-Bromo-1H-indol-3-yl)-2,2-dimethylpropyl acetate, 95%, 95%. Offered by: Chemat. Available pack sizes: 25g, 100g.
[3-(5-bromo-1H-indol-3-yl)-2,2-dimethylpropyl] acetate (CAS 2641451-61-6) is a chemical compound with the molecular formula C15H18BrNO2 and a molecular weight of 324.21 g/mol. IUPAC name: [3-(5-bromo-1H-indol-3-yl)-2,2-dimethylpropyl] acetate. InChIKey: BRCDOFCLMDNAGM-UHFFFAOYSA-N.
| Molecular formula | C15H18BrNO2 |
|---|---|
| Molecular weight | 324.21 g/mol |
| IUPAC name | [3-(5-bromo-1H-indol-3-yl)-2,2-dimethylpropyl] acetate |
| InChIKey | BRCDOFCLMDNAGM-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC(C)(C)CC1=CNC2=C1C=C(C=C2)Br |
Computed by PubChem (NCBI)