Products 2845195-91-5
CAS 2845195-91-5 is the registry number for tert-Butyl 5'-bromospiro[cyclopropane-1,3'-indoline]-1'-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 5-bromospiro[2H-indole-3,1'-cyclopropane]-1-carboxylate (CAS 2845195-91-5) is a chemical compound with the molecular formula C15H18BrNO2 and a molecular weight of 324.21 g/mol. IUPAC name: tert-butyl 5-bromospiro[2H-indole-3,1'-cyclopropane]-1-carboxylate. InChIKey: MEWFRHMUMOKXRM-UHFFFAOYSA-N.
| Molecular formula | C15H18BrNO2 |
|---|---|
| Molecular weight | 324.21 g/mol |
| IUPAC name | tert-butyl 5-bromospiro[2H-indole-3,1'-cyclopropane]-1-carboxylate |
| InChIKey | MEWFRHMUMOKXRM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(CC2)C3=C1C=CC(=C3)Br |
Computed by PubChem (NCBI)