Products 2641825-07-0
CAS 2641825-07-0 is the registry number for (2S,3R)-3-Cyclopropylaziridine-2-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S,3R)-3-cyclopropylaziridine-2-carboxylic acid (CAS 2641825-07-0) is a chemical compound with the molecular formula C6H9NO2 and a molecular weight of 127.14 g/mol. IUPAC name: (2S,3R)-3-cyclopropylaziridine-2-carboxylic acid. InChIKey: CSWUNYKZMHJOPZ-UHNVWZDZSA-N.
| Molecular formula | C6H9NO2 |
|---|---|
| Molecular weight | 127.14 g/mol |
| IUPAC name | (2S,3R)-3-cyclopropylaziridine-2-carboxylic acid |
| InChIKey | CSWUNYKZMHJOPZ-UHNVWZDZSA-N |
| SMILES | C1CC1[C@@H]2[C@H](N2)C(=O)O |
Computed by PubChem (NCBI)