Products 26422-85-5
CAS 26422-85-5 is the registry number for 9H-Pyrrolo[2,3-b:4,5-c']dipyridine, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (CAS 26422-85-5) is a chemical compound with the molecular formula C10H7N3 and a molecular weight of 169.18 g/mol. IUPAC name: 4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene. InChIKey: DNALPMZQPFKJRV-UHFFFAOYSA-N.
| Molecular formula | C10H7N3 |
|---|---|
| Molecular weight | 169.18 g/mol |
| IUPAC name | 4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| InChIKey | DNALPMZQPFKJRV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(NC3=C2C=NC=C3)N=C1 |
Computed by PubChem (NCBI)