Products 2642377-55-5
CAS 2642377-55-5 is the registry number for ((2S,4S,5S)-5-Amino-4-fluorotetrahydro-2H-pyran-2-yl)methanol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[(2S,4S,5S)-5-amino-4-fluorooxan-2-yl]methanol (CAS 2642377-55-5) is a chemical compound with the molecular formula C6H12FNO2 and a molecular weight of 149.16 g/mol. IUPAC name: [(2S,4S,5S)-5-amino-4-fluorooxan-2-yl]methanol. InChIKey: XYRUFDAKVKGABJ-ZLUOBGJFSA-N.
| Molecular formula | C6H12FNO2 |
|---|---|
| Molecular weight | 149.16 g/mol |
| IUPAC name | [(2S,4S,5S)-5-amino-4-fluorooxan-2-yl]methanol |
| InChIKey | XYRUFDAKVKGABJ-ZLUOBGJFSA-N |
| SMILES | C1[C@H](OC[C@@H]([C@H]1F)N)CO |
Computed by PubChem (NCBI)