Products 2660255-56-9
CAS 2660255-56-9 is the registry number for rel-(3R,4R,5S)-5-Fluoro-4-methoxypiperidin-3-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3R,4R,5S)-5-fluoro-4-methoxypiperidin-3-ol (CAS 2660255-56-9) is a chemical compound with the molecular formula C6H12FNO2 and a molecular weight of 149.16 g/mol. IUPAC name: (3R,4R,5S)-5-fluoro-4-methoxypiperidin-3-ol. InChIKey: CHNIVCBRTMGQTI-JKUQZMGJSA-N.
| Molecular formula | C6H12FNO2 |
|---|---|
| Molecular weight | 149.16 g/mol |
| IUPAC name | (3R,4R,5S)-5-fluoro-4-methoxypiperidin-3-ol |
| InChIKey | CHNIVCBRTMGQTI-JKUQZMGJSA-N |
| SMILES | CO[C@@H]1[C@@H](CNC[C@@H]1F)O |
Computed by PubChem (NCBI)