Products 2642394-38-3
CAS 2642394-38-3 appears in our catalog under these names: Mtb ATP synthase-IN-1/ 98.28% (existing batch purity), Mtb ATP synthase–IN–1, Mtb ATP synthase-IN-1 98%, 3-(Benzo[d][1,3]dioxol-5-ylamino)-4-((pyridin-2-ylmethyl)amino)cyclobut-3-ene-1,2-dione, 98%, 98%, Mtb ATP synthase-IN-1, 98.55%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM * 1mlindmso, 250mg.
3-(1,3-benzodioxol-5-ylamino)-4-(pyridin-2-ylmethylamino)cyclobut-3-ene-1,2-dione (CAS 2642394-38-3) is a chemical compound with the molecular formula C17H13N3O4 and a molecular weight of 323.30 g/mol. IUPAC name: 3-(1,3-benzodioxol-5-ylamino)-4-(pyridin-2-ylmethylamino)cyclobut-3-ene-1,2-dione. InChIKey: ZEYYGLIHJGBVNS-UHFFFAOYSA-N.
| Molecular formula | C17H13N3O4 |
|---|---|
| Molecular weight | 323.30 g/mol |
| IUPAC name | 3-(1,3-benzodioxol-5-ylamino)-4-(pyridin-2-ylmethylamino)cyclobut-3-ene-1,2-dione |
| InChIKey | ZEYYGLIHJGBVNS-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)NC3=C(C(=O)C3=O)NCC4=CC=CC=N4 |
Computed by PubChem (NCBI)
Synonyms:
Mtb ATP synthase-IN-1, orb1689156