CAS 264264-33-7 appears in our catalog under these names: 3-(1H-Pyrazol-1-yl)benzoic acid, 98%, 3-(1H-Pyrazol-1-yl)benzoic acid, 97%, 97%. Offered by: Combi-blocks, Chemat. Available pack sizes: 25g, 100g, 1g, 5g, 250mg.
3-pyrazol-1-ylbenzoic acid (CAS 264264-33-7) is a chemical compound with the molecular formula C10H8N2O2 and a molecular weight of 188.18 g/mol. IUPAC name: 3-pyrazol-1-ylbenzoic acid. InChIKey: KLMWJDGRIJPPSS-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O2 |
|---|---|
| Molecular weight | 188.18 g/mol |
| IUPAC name | 3-pyrazol-1-ylbenzoic acid |
| InChIKey | KLMWJDGRIJPPSS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N2C=CC=N2)C(=O)O |
Computed by PubChem (NCBI)