Products 2642725-86-6
CAS 2642725-86-6 is the registry number for N-Fmoc-N-methyl-O-cyclopropyl-L-serine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-3-cyclopropyloxy-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]propanoic acid (CAS 2642725-86-6) is a chemical compound with the molecular formula C22H23NO5 and a molecular weight of 381.4 g/mol. IUPAC name: (2S)-3-cyclopropyloxy-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]propanoic acid. InChIKey: ZBRITNKXUJDONW-FQEVSTJZSA-N.
| Molecular formula | C22H23NO5 |
|---|---|
| Molecular weight | 381.4 g/mol |
| IUPAC name | (2S)-3-cyclopropyloxy-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]propanoic acid |
| InChIKey | ZBRITNKXUJDONW-FQEVSTJZSA-N |
| SMILES | CN([C@@H](COC1CC1)C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)