CAS 946716-29-6 appears in our catalog under these names: Fmoc-4-aminomethyl-tetrahydropyran-4-carboxylic acid, 95%, Fmoc-4-aminomethyl-THP-COOH, Fmoc-4-(aminomethyl)-oxan-4-carboxylic acid 95%, FMOC-4-AMINOMETHYL-TETRAHYDROPYRAN-4-CARBOXYLIC ACID, 95%, 95%, Fmoc-4-aminomethyl-tetrahydropyran-4-carboxylic acid, 97%. Offered by: Combi-blocks, Iris Biotech, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
4-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]oxane-4-carboxylic acid (CAS 946716-29-6) is a chemical compound with the molecular formula C22H23NO5 and a molecular weight of 381.4 g/mol. IUPAC name: 4-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]oxane-4-carboxylic acid. InChIKey: VPBOLCNCZREYGI-UHFFFAOYSA-N.
| Molecular formula | C22H23NO5 |
|---|---|
| Molecular weight | 381.4 g/mol |
| IUPAC name | 4-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]oxane-4-carboxylic acid |
| InChIKey | VPBOLCNCZREYGI-UHFFFAOYSA-N |
| SMILES | C1COCCC1(CNC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O |
Computed by PubChem (NCBI)