CAS 2644-99-7 is the registry number for 2-(N-Methyl4-methylbenzenesulfonamido)acetic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
2-[methyl-(4-methylphenyl)sulfonylamino]acetic acid (CAS 2644-99-7) is a chemical compound with the molecular formula C10H13NO4S and a molecular weight of 243.28 g/mol. IUPAC name: 2-[methyl-(4-methylphenyl)sulfonylamino]acetic acid. InChIKey: XRAFYUFZCCCVEY-UHFFFAOYSA-N.
| Molecular formula | C10H13NO4S |
|---|---|
| Molecular weight | 243.28 g/mol |
| IUPAC name | 2-[methyl-(4-methylphenyl)sulfonylamino]acetic acid |
| InChIKey | XRAFYUFZCCCVEY-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N(C)CC(=O)O |
Computed by PubChem (NCBI)