Products 2644649-59-0
CAS 2644649-59-0 is the registry number for tert-Butyl (2R)-6,6-difluoro-2-(hydroxymethyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (2R)-6,6-difluoro-2-(hydroxymethyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate (CAS 2644649-59-0) is a chemical compound with the molecular formula C11H17F2NO3 and a molecular weight of 249.25 g/mol. IUPAC name: tert-butyl (2R)-6,6-difluoro-2-(hydroxymethyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate. InChIKey: WXRBHNDJZWUTPR-WTIBDHCWSA-N.
| Molecular formula | C11H17F2NO3 |
|---|---|
| Molecular weight | 249.25 g/mol |
| IUPAC name | tert-butyl (2R)-6,6-difluoro-2-(hydroxymethyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate |
| InChIKey | WXRBHNDJZWUTPR-WTIBDHCWSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2C([C@@H]1CO)C2(F)F |
Computed by PubChem (NCBI)