Products 2920414-89-5
CAS 2920414-89-5 is the registry number for tert-butyl 3,3-difluoro-6-oxo-azepane-1-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 3,3-difluoro-6-oxoazepane-1-carboxylate (CAS 2920414-89-5) is a chemical compound with the molecular formula C11H17F2NO3 and a molecular weight of 249.25 g/mol. IUPAC name: tert-butyl 3,3-difluoro-6-oxoazepane-1-carboxylate. InChIKey: HWYXFUPUFSOPAO-UHFFFAOYSA-N.
| Molecular formula | C11H17F2NO3 |
|---|---|
| Molecular weight | 249.25 g/mol |
| IUPAC name | tert-butyl 3,3-difluoro-6-oxoazepane-1-carboxylate |
| InChIKey | HWYXFUPUFSOPAO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(=O)CCC(C1)(F)F |
Computed by PubChem (NCBI)