Products 2638505-12-9
CAS 2638505-12-9 is the registry number for tert-butyl (2S)-4-(difluoromethylene)-2-(hydroxymethyl)pyrrolidine-1-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
Tert-butyl (2S)-4-(difluoromethylidene)-2-(hydroxymethyl)pyrrolidine-1-carboxylate (CAS 2638505-12-9) is a chemical compound with the molecular formula C11H17F2NO3 and a molecular weight of 249.25 g/mol. IUPAC name: tert-butyl (2S)-4-(difluoromethylidene)-2-(hydroxymethyl)pyrrolidine-1-carboxylate. InChIKey: BEAWXFMOEGDRIU-QMMMGPOBSA-N.
| Molecular formula | C11H17F2NO3 |
|---|---|
| Molecular weight | 249.25 g/mol |
| IUPAC name | tert-butyl (2S)-4-(difluoromethylidene)-2-(hydroxymethyl)pyrrolidine-1-carboxylate |
| InChIKey | BEAWXFMOEGDRIU-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(=C(F)F)C[C@H]1CO |
Computed by PubChem (NCBI)