CAS 2647465-26-5 is the registry number for 7-Amino-8-hydroxythiochromane 1,1-dioxide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
7-amino-1,1-dioxo-3,4-dihydro-2H-thiochromen-8-ol (CAS 2647465-26-5) is a chemical compound with the molecular formula C9H11NO3S and a molecular weight of 213.26 g/mol. IUPAC name: 7-amino-1,1-dioxo-3,4-dihydro-2H-thiochromen-8-ol. InChIKey: LQQKBOGXQPOKPG-UHFFFAOYSA-N.
| Molecular formula | C9H11NO3S |
|---|---|
| Molecular weight | 213.26 g/mol |
| IUPAC name | 7-amino-1,1-dioxo-3,4-dihydro-2H-thiochromen-8-ol |
| InChIKey | LQQKBOGXQPOKPG-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=C(C=C2)N)O)S(=O)(=O)C1 |
Computed by PubChem (NCBI)