CAS 2648122-56-7 is the registry number for 4,7-Di(1H-1,2,4-triazol-1-yl)benzo[c][1,2,5]thiadiazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4,7-bis(1,2,4-triazol-1-yl)-2,1,3-benzothiadiazole (CAS 2648122-56-7) is a chemical compound with the molecular formula C10H6N8S and a molecular weight of 270.28 g/mol. IUPAC name: 4,7-bis(1,2,4-triazol-1-yl)-2,1,3-benzothiadiazole. InChIKey: BMECAHBIWZEJHK-UHFFFAOYSA-N.
| Molecular formula | C10H6N8S |
|---|---|
| Molecular weight | 270.28 g/mol |
| IUPAC name | 4,7-bis(1,2,4-triazol-1-yl)-2,1,3-benzothiadiazole |
| InChIKey | BMECAHBIWZEJHK-UHFFFAOYSA-N |
| SMILES | C1=C(C2=NSN=C2C(=C1)N3C=NC=N3)N4C=NC=N4 |
Computed by PubChem (NCBI)