CAS 90947-51-6 appears in our catalog under these names: Di(7H-purin-6-yl)sulfane, 95%, Azathioprine Impurity 11, 6,6'-Thiobis-9H-purine, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg, 50mg.
6-(7H-purin-6-ylsulfanyl)-7H-purine (CAS 90947-51-6) is a chemical compound with the molecular formula C10H6N8S and a molecular weight of 270.28 g/mol. IUPAC name: 6-(7H-purin-6-ylsulfanyl)-7H-purine. InChIKey: RRQKBHIMPMKQDM-UHFFFAOYSA-N.
| Molecular formula | C10H6N8S |
|---|---|
| Molecular weight | 270.28 g/mol |
| IUPAC name | 6-(7H-purin-6-ylsulfanyl)-7H-purine |
| InChIKey | RRQKBHIMPMKQDM-UHFFFAOYSA-N |
| SMILES | C1=NC2=C(N1)C(=NC=N2)SC3=NC=NC4=C3NC=N4 |
Computed by PubChem (NCBI)