Products 2648588-76-3
CAS 2648588-76-3 is the registry number for 3-(Bromodifluoromethyl)-5-chlorobenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[bromo(difluoro)methyl]-5-chlorobenzoic acid (CAS 2648588-76-3) is a chemical compound with the molecular formula C8H4BrClF2O2 and a molecular weight of 285.47 g/mol. IUPAC name: 3-[bromo(difluoro)methyl]-5-chlorobenzoic acid. InChIKey: GSPLNPSPVPFZLZ-UHFFFAOYSA-N.
| Molecular formula | C8H4BrClF2O2 |
|---|---|
| Molecular weight | 285.47 g/mol |
| IUPAC name | 3-[bromo(difluoro)methyl]-5-chlorobenzoic acid |
| InChIKey | GSPLNPSPVPFZLZ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(F)(F)Br)Cl)C(=O)O |
Computed by PubChem (NCBI)